C21H26BClO4 — CID 170560636
[5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 170560636) has the molecular formula C21H26BClO4 and a molecular weight of 388.70 g/mol. Its IUPAC name is [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170560636 |
| Molecular Formula | C21H26BClO4 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cc(B2OC(C)(C)C(C)(C)O2)c2c(Cl)cccc2c1 |
| InChI | InChI=1S/C21H26BClO4/c1-19(2,3)18(24)25-14-11-13-9-8-10-16(23)17(13)15(12-14)22-26-20(4,5)21(6,7)27-22/h8-12H,1-7H3 |
| InChIKey | YTZMTSWFYUATIQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|