C22H33BO4 — CID 91551457
ethane;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate (PubChem CID 91551457) has the molecular formula C22H33BO4 and a molecular weight of 372.31 g/mol. Its IUPAC name is ethane;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate.
| Compound Name | ethane;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 91551457 |
| Molecular Formula | C22H33BO4 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | ethane;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate |
| SMILES | CC.CC.COC(=O)c1cc2ccccc2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H21BO4.2C2H6/c1-17(2)18(3,4)23-19(22-17)15-11-13-9-7-6-8-12(13)10-14(15)16(20)21-5;2*1-2/h6-11H,1-5H3;2*1-2H3 |
| InChIKey | XCPAVEVJPRQEKT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|