C21H30B2O8 — CID 123734445
4-methoxycarbonyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 123734445) has the molecular formula C21H30B2O8 and a molecular weight of 432.09 g/mol. Its IUPAC name is 4-methoxycarbonyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 4-methoxycarbonyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 123734445 |
| Molecular Formula | C21H30B2O8 |
| Molecular Weight | 432.09 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 4-methoxycarbonyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | COC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c(C(=O)O)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H30B2O8/c1-18(2)19(3,4)29-22(28-18)14-11-13(17(26)27-9)15(10-12(14)16(24)25)23-30-20(5,6)21(7,8)31-23/h10-11H,1-9H3,(H,24,25) |
| InChIKey | KBTDSTOZHLHELS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.09 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|