C16H20BNO5 — CID 172643994
methyl 5-cyano-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 172643994) has the molecular formula C16H20BNO5 and a molecular weight of 317.15 g/mol. Its IUPAC name is methyl 5-cyano-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 5-cyano-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 172643994 |
| Molecular Formula | C16H20BNO5 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 5-cyano-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1cc(C#N)c(B2OC(C)(C)C(C)(C)O2)cc1OC |
| InChI | InChI=1S/C16H20BNO5/c1-15(2)16(3,4)23-17(22-15)12-8-13(20-5)11(14(19)21-6)7-10(12)9-18/h7-8H,1-6H3 |
| InChIKey | MAOCNIWEYABULT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|