C16H17BF3NO4 — CID 172645175
methyl 4-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate (PubChem CID 172645175) has the molecular formula C16H17BF3NO4 and a molecular weight of 355.12 g/mol. Its IUPAC name is methyl 4-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 172645175 |
| Molecular Formula | C16H17BF3NO4 |
| Molecular Weight | 355.12 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | methyl 4-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C16H17BF3NO4/c1-14(2)15(3,4)25-17(24-14)12-7-10(13(22)23-5)11(16(18,19)20)6-9(12)8-21/h6-7H,1-5H3 |
| InChIKey | JYOCUNIRISZZIT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|