C16H23BO4 — CID 71039272
methyl 2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 71039272) has the molecular formula C16H23BO4 and a molecular weight of 290.17 g/mol. Its IUPAC name is methyl 2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 71039272 |
| Molecular Formula | C16H23BO4 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | methyl 2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CCc1c(B2OC(C)(C)C(C)(C)O2)cccc1C(=O)OC |
| InChI | InChI=1S/C16H23BO4/c1-7-11-12(14(18)19-6)9-8-10-13(11)17-20-15(2,3)16(4,5)21-17/h8-10H,7H2,1-6H3 |
| InChIKey | AVMPHQBFMIXERA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|