C18H27BO4 — CID 123952766
4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid (PubChem CID 123952766) has the molecular formula C18H27BO4 and a molecular weight of 318.22 g/mol. Its IUPAC name is 4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid.
| Compound Name | 4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 123952766 |
| Molecular Formula | C18H27BO4 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid |
| SMILES | CCc1c(CCCC(=O)O)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H27BO4/c1-6-14-13(10-8-12-16(20)21)9-7-11-15(14)19-22-17(2,3)18(4,5)23-19/h7,9,11H,6,8,10,12H2,1-5H3,(H,20,21) |
| InChIKey | HKGIBDZYEBUEOZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|