4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid

C12H13NO4 — CID 117341847

IUPAC4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid
SMILESO=C(O)CCCc1cccc2c1OCC(=O)N2
InChIInChI=1S/C12H13NO4/c14-10-7-17-12-8(4-2-6-11(15)16)3-1-5-9(12)13-10/h1,3,5H,2,4,6-7H2,(H,13,14)(H,15,16)
InChIKeyJUHNMGZRDWTPOY-UHFFFAOYSA-N
MW235.24 g/mol
LogP1.42
Rot. Bonds4

About 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid

4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid (PubChem CID 117341847) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid.

Molecular Properties

Compound Name4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid
PubChem CID117341847
Molecular FormulaC12H13NO4
Molecular Weight235.24 g/mol
Exact Mass235.08
IUPAC Name4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid
SMILESO=C(O)CCCc1cccc2c1OCC(=O)N2
InChIInChI=1S/C12H13NO4/c14-10-7-17-12-8(4-2-6-11(15)16)3-1-5-9(12)13-10/h1,3,5H,2,4,6-7H2,(H,13,14)(H,15,16)
InChIKeyJUHNMGZRDWTPOY-UHFFFAOYSA-N
XLogP1.42
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.24
LogP ≤ 51.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid?
The IUPAC name of 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid (CID 117341847) is 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid.
What is the SMILES notation for 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid?
The canonical SMILES for 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid is O=C(O)CCCc1cccc2c1OCC(=O)N2.
What is the InChIKey of 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid?
The InChIKey is JUHNMGZRDWTPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c14-10-7-17-12-8(4-2-6-11(15)16)3-1-5-9(12)13-10/h1,3,5H,2,4,6-7H2,(H,13,14)(H,15,16).
What are the key properties of 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid?
4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid has a molecular weight of 235.24 g/mol, XLogP of 1.42, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-oxo-4H-1,4-benzoxazin-8-yl)butanoic acid is sourced from PubChem (CID 117341847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).