C10H12N2O3 — CID 118692879
8-(2-amino-1-hydroxyethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 118692879) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 8-(2-amino-1-hydroxyethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-(2-amino-1-hydroxyethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 118692879 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 8-(2-amino-1-hydroxyethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | NCC(O)c1cccc2c1OCC(=O)N2 |
| InChI | InChI=1S/C10H12N2O3/c11-4-8(13)6-2-1-3-7-10(6)15-5-9(14)12-7/h1-3,8,13H,4-5,11H2,(H,12,14) |
| InChIKey | JRUDXCKJHUGQLC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |