C11H11NO5 — CID 117346035
methyl 2-hydroxy-2-(3-oxo-4H-1,4-benzoxazin-8-yl)acetate (PubChem CID 117346035) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is methyl 2-hydroxy-2-(3-oxo-4H-1,4-benzoxazin-8-yl)acetate.
| Compound Name | methyl 2-hydroxy-2-(3-oxo-4H-1,4-benzoxazin-8-yl)acetate |
|---|---|
| PubChem CID | 117346035 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | methyl 2-hydroxy-2-(3-oxo-4H-1,4-benzoxazin-8-yl)acetate |
| SMILES | COC(=O)C(O)c1cccc2c1OCC(=O)N2 |
| InChI | InChI=1S/C11H11NO5/c1-16-11(15)9(14)6-3-2-4-7-10(6)17-5-8(13)12-7/h2-4,9,14H,5H2,1H3,(H,12,13) |
| InChIKey | DACWGKDBOQCDBM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |