C10H13N3O4S — CID 110291818
8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine (PubChem CID 110291818) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine.
| Compound Name | 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine |
|---|---|
| PubChem CID | 110291818 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine |
| SMILES | CN(C)S(=O)(=O)Nc1cccc2c1OCC(=O)N2 |
| InChI | InChI=1S/C10H13N3O4S/c1-13(2)18(15,16)12-8-5-3-4-7-10(8)17-6-9(14)11-7/h3-5,12H,6H2,1-2H3,(H,11,14) |
| InChIKey | KGHZNFUEPPPCCX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |