About 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine
8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine (PubChem CID 110291818) has the molecular formula C10H13N3O4S
and a molecular weight of 271.30 g/mol. Its IUPAC name is 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine |
| PubChem CID | 110291818 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine |
| SMILES | CN(C)S(=O)(=O)Nc1cccc2c1OCC(=O)N2 |
| InChI | InChI=1S/C10H13N3O4S/c1-13(2)18(15,16)12-8-5-3-4-7-10(8)17-6-9(14)11-7/h3-5,12H,6H2,1-2H3,(H,11,14) |
| InChIKey | KGHZNFUEPPPCCX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine?
The IUPAC name of 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine (CID 110291818) is 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine.
What is the SMILES notation for 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine?
The canonical SMILES for 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine is CN(C)S(=O)(=O)Nc1cccc2c1OCC(=O)N2.
What is the InChIKey of 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine?
The InChIKey is KGHZNFUEPPPCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4S/c1-13(2)18(15,16)12-8-5-3-4-7-10(8)17-6-9(14)11-7/h3-5,12H,6H2,1-2H3,(H,11,14).
What are the key properties of 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine?
8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine has a molecular weight of 271.30 g/mol, XLogP of 0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(dimethylsulfamoylamino)-3-oxo-4H-1,4-benzoxazine is sourced from PubChem (CID 110291818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).