C8H6ClNO4S — CID 55279078
3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride (PubChem CID 55279078) has the molecular formula C8H6ClNO4S and a molecular weight of 247.66 g/mol. Its IUPAC name is 3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride.
| Compound Name | 3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride |
|---|---|
| PubChem CID | 55279078 |
| Molecular Formula | C8H6ClNO4S |
| Molecular Weight | 247.66 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride |
| SMILES | O=C1COc2c(cccc2S(=O)(=O)Cl)N1 |
| InChI | InChI=1S/C8H6ClNO4S/c9-15(12,13)6-3-1-2-5-8(6)14-4-7(11)10-5/h1-3H,4H2,(H,10,11) |
| InChIKey | GIQBGPOMMXZMRA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.66 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |