C11H15N3O4S — CID 110729693
8-(dimethylsulfamoylamino)-6-methyl-3-oxo-4H-1,4-benzoxazine (PubChem CID 110729693) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 8-(dimethylsulfamoylamino)-6-methyl-3-oxo-4H-1,4-benzoxazine.
| Compound Name | 8-(dimethylsulfamoylamino)-6-methyl-3-oxo-4H-1,4-benzoxazine |
|---|---|
| PubChem CID | 110729693 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 8-(dimethylsulfamoylamino)-6-methyl-3-oxo-4H-1,4-benzoxazine |
| SMILES | Cc1cc2c(c(NS(=O)(=O)N(C)C)c1)OCC(=O)N2 |
| InChI | InChI=1S/C11H15N3O4S/c1-7-4-8-11(18-6-10(15)12-8)9(5-7)13-19(16,17)14(2)3/h4-5,13H,6H2,1-3H3,(H,12,15) |
| InChIKey | CEUBKZSRYWDGDM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |