C15H13ClN2O5S — CID 110291828
3-chloro-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide (PubChem CID 110291828) has the molecular formula C15H13ClN2O5S and a molecular weight of 368.80 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110291828 |
| Molecular Formula | C15H13ClN2O5S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 3-chloro-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc3c2OCC(=O)N3)cc1Cl |
| InChI | InChI=1S/C15H13ClN2O5S/c1-22-13-6-5-9(7-10(13)16)24(20,21)18-12-4-2-3-11-15(12)23-8-14(19)17-11/h2-7,18H,8H2,1H3,(H,17,19) |
| InChIKey | ZRJTUTPWHUZVCG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |