C18H21BO4 — CID 58553362
methyl 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate (PubChem CID 58553362) has the molecular formula C18H21BO4 and a molecular weight of 312.17 g/mol. Its IUPAC name is methyl 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate.
| Compound Name | methyl 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58553362 |
| Molecular Formula | C18H21BO4 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | methyl 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cccc(B3OC(C)(C)C(C)(C)O3)c2c1 |
| InChI | InChI=1S/C18H21BO4/c1-17(2)18(3,4)23-19(22-17)15-8-6-7-12-9-10-13(11-14(12)15)16(20)21-5/h6-11H,1-5H3 |
| InChIKey | ABSSWBWDLCVDKZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|