C21H28BNO3 — CID 171396835
N-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide (PubChem CID 171396835) has the molecular formula C21H28BNO3 and a molecular weight of 353.27 g/mol. Its IUPAC name is N-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide.
| Compound Name | N-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 171396835 |
| Molecular Formula | C21H28BNO3 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(B3OC(C)(C)C(C)(C)O3)cccc2c1 |
| InChI | InChI=1S/C21H28BNO3/c1-6-7-13-23-19(24)16-11-12-17-15(14-16)9-8-10-18(17)22-25-20(2,3)21(4,5)26-22/h8-12,14H,6-7,13H2,1-5H3,(H,23,24) |
| InChIKey | JLZLOPKJRJCZKO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|