C28H40BNO4Si — CID 174214021
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl] carbamate (PubChem CID 174214021) has the molecular formula C28H40BNO4Si and a molecular weight of 493.53 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl] carbamate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl] carbamate |
|---|---|
| PubChem CID | 174214021 |
| Molecular Formula | C28H40BNO4Si |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl] carbamate |
| SMILES | CC(C)[Si](C#Cc1cccc2cc(OC(N)=O)cc(B3OC(C)(C)C(C)(C)O3)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H40BNO4Si/c1-18(2)35(19(3)4,20(5)6)15-14-21-12-11-13-22-16-23(32-26(30)31)17-24(25(21)22)29-33-27(7,8)28(9,10)34-29/h11-13,16-20H,1-10H3,(H2,30,31) |
| InChIKey | AJSRKXXJYNLDLZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|