C30H51BN2O3Si2 — CID 171568076
trimethyl-[2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]indazol-1-yl]methoxy]ethyl]silane (PubChem CID 171568076) has the molecular formula C30H51BN2O3Si2 and a molecular weight of 554.73 g/mol. Its IUPAC name is trimethyl-[2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]indazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]indazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 171568076 |
| Molecular Formula | C30H51BN2O3Si2 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | trimethyl-[2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]indazol-1-yl]methoxy]ethyl]silane |
| SMILES | CC(C)[Si](C#Cc1cccc2c1c(B1OC(C)(C)C(C)(C)O1)nn2COCC[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H51BN2O3Si2/c1-22(2)38(23(3)4,24(5)6)19-17-25-15-14-16-26-27(25)28(31-35-29(7,8)30(9,10)36-31)32-33(26)21-34-18-20-37(11,12)13/h14-16,22-24H,18,20-21H2,1-13H3 |
| InChIKey | WFYNEWJDIIGKNR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|