C23H38BNO2Si — CID 176801128
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]aniline (PubChem CID 176801128) has the molecular formula C23H38BNO2Si and a molecular weight of 399.46 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]aniline.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]aniline |
|---|---|
| PubChem CID | 176801128 |
| Molecular Formula | C23H38BNO2Si |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]aniline |
| SMILES | CC(C)[Si](C#Cc1ccc(N)cc1B1OC(C)(C)C(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H38BNO2Si/c1-16(2)28(17(3)4,18(5)6)14-13-19-11-12-20(25)15-21(19)24-26-22(7,8)23(9,10)27-24/h11-12,15-18H,25H2,1-10H3 |
| InChIKey | FMLQYLZLKDIWGL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|