C14H16BO2Si — CID 175127785
CID 175127785 (PubChem CID 175127785) has the molecular formula C14H16BO2Si and a molecular weight of 255.18 g/mol.
| Compound Name | CID 175127785 |
|---|---|
| PubChem CID | 175127785 |
| Molecular Formula | C14H16BO2Si |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(c2ccccc2C#C[Si])OC1(C)C |
| InChI | InChI=1S/C14H16BO2Si/c1-13(2)14(3,4)17-15(16-13)12-8-6-5-7-11(12)9-10-18/h5-8H,1-4H3 |
| InChIKey | RQHYUIRXFSWZMJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|