C13H18BBrO2Zn — CID 146002621
bromozinc(1+);2-(2-methanidylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 146002621) has the molecular formula C13H18BBrO2Zn and a molecular weight of 362.39 g/mol. Its IUPAC name is bromozinc(1+);2-(2-methanidylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | bromozinc(1+);2-(2-methanidylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 146002621 |
| Molecular Formula | C13H18BBrO2Zn |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | bromozinc(1+);2-(2-methanidylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [CH2-]c1ccccc1B1OC(C)(C)C(C)(C)O1.[Zn+]Br |
| InChI | InChI=1S/C13H18BO2.BrH.Zn/c1-10-8-6-7-9-11(10)14-15-12(2,3)13(4,5)16-14;;/h6-9H,1H2,2-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | QLABGELTZDJOOB-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|