C14H22BO2Si — CID 131579330
CID 131579330 (PubChem CID 131579330) has the molecular formula C14H22BO2Si and a molecular weight of 261.23 g/mol.
| Compound Name | CID 131579330 |
|---|---|
| PubChem CID | 131579330 |
| Molecular Formula | C14H22BO2Si |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H22BO2Si/c1-13(2)14(3,4)17-15(16-13)11-9-7-8-10-12(11)18(5)6/h7-10H,1-6H3 |
| InChIKey | PKAIYKDGMJQVKP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|