C13H19BN2O2 — CID 68525635
[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazine (PubChem CID 68525635) has the molecular formula C13H19BN2O2 and a molecular weight of 246.12 g/mol. Its IUPAC name is [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazine.
| Compound Name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 68525635 |
| Molecular Formula | C13H19BN2O2 |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazine |
| SMILES | CC1(C)OB(c2ccccc2C=NN)OC1(C)C |
| InChI | InChI=1S/C13H19BN2O2/c1-12(2)13(3,4)18-14(17-12)11-8-6-5-7-10(11)9-16-15/h5-9H,15H2,1-4H3 |
| InChIKey | HKUCMUWJTUQOOL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|