C19H29BO3 — CID 170605684
ethane;(E)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-4-en-2-one (PubChem CID 170605684) has the molecular formula C19H29BO3 and a molecular weight of 316.25 g/mol. Its IUPAC name is ethane;(E)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-4-en-2-one.
| Compound Name | ethane;(E)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-4-en-2-one |
|---|---|
| PubChem CID | 170605684 |
| Molecular Formula | C19H29BO3 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | ethane;(E)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-4-en-2-one |
| SMILES | CC.CC(=O)C/C=C/c1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BO3.C2H6/c1-13(19)9-8-11-14-10-6-7-12-15(14)18-20-16(2,3)17(4,5)21-18;1-2/h6-8,10-12H,9H2,1-5H3;1-2H3/b11-8+; |
| InChIKey | JRQZFJGDICEZTG-YGCVIUNWSA-N |
| XLogP | 4.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|