C16H21BO4 — CID 141496580
(E)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-enoic acid (PubChem CID 141496580) has the molecular formula C16H21BO4 and a molecular weight of 288.15 g/mol. Its IUPAC name is (E)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-enoic acid.
| Compound Name | (E)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 141496580 |
| Molecular Formula | C16H21BO4 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (E)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-enoic acid |
| SMILES | CC1(C)OB(c2ccc(/C=C/CC(=O)O)cc2)OC1(C)C |
| InChI | InChI=1S/C16H21BO4/c1-15(2)16(3,4)21-17(20-15)13-10-8-12(9-11-13)6-5-7-14(18)19/h5-6,8-11H,7H2,1-4H3,(H,18,19)/b6-5+ |
| InChIKey | MOIOZUDXTMPTCA-AATRIKPKSA-N |
| XLogP | 2.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|