C18H23BO3 — CID 177157847
(1E,3Z,5Z)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexa-1,3,5-trien-1-ol (PubChem CID 177157847) has the molecular formula C18H23BO3 and a molecular weight of 298.19 g/mol. Its IUPAC name is (1E,3Z,5Z)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexa-1,3,5-trien-1-ol.
| Compound Name | (1E,3Z,5Z)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexa-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 177157847 |
| Molecular Formula | C18H23BO3 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (1E,3Z,5Z)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hexa-1,3,5-trien-1-ol |
| SMILES | CC1(C)OB(c2ccc(/C=C\C=C/C=C/O)cc2)OC1(C)C |
| InChI | InChI=1S/C18H23BO3/c1-17(2)18(3,4)22-19(21-17)16-12-10-15(11-13-16)9-7-5-6-8-14-20/h5-14,20H,1-4H3/b6-5-,9-7-,14-8+ |
| InChIKey | YHSCQRDIOLCDRN-HXMGQZSESA-N |
| XLogP | 3.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|