C19H27BO3 — CID 175552582
4,4,5,5-tetramethyl-2-[4-[2-(oxan-4-yl)ethenyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 175552582) has the molecular formula C19H27BO3 and a molecular weight of 314.23 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[2-(oxan-4-yl)ethenyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[2-(oxan-4-yl)ethenyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 175552582 |
| Molecular Formula | C19H27BO3 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[2-(oxan-4-yl)ethenyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(C=CC3CCOCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H27BO3/c1-18(2)19(3,4)23-20(22-18)17-9-7-15(8-10-17)5-6-16-11-13-21-14-12-16/h5-10,16H,11-14H2,1-4H3 |
| InChIKey | JZADWKOVDWPDAX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|