C17H26BNO5S — CID 69267301
N-(oxan-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 69267301) has the molecular formula C17H26BNO5S and a molecular weight of 367.28 g/mol. Its IUPAC name is N-(oxan-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-(oxan-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 69267301 |
| Molecular Formula | C17H26BNO5S |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-(oxan-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)NC3CCOCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C17H26BNO5S/c1-16(2)17(3,4)24-18(23-16)13-5-7-15(8-6-13)25(20,21)19-14-9-11-22-12-10-14/h5-8,14,19H,9-12H2,1-4H3 |
| InChIKey | NMRSRCPBCGXUBI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|