C16H24BNO3S — CID 175297797
cyclopropylimino-methyl-oxo-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane (PubChem CID 175297797) has the molecular formula C16H24BNO3S and a molecular weight of 321.25 g/mol. Its IUPAC name is cyclopropylimino-methyl-oxo-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane.
| Compound Name | cyclopropylimino-methyl-oxo-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 175297797 |
| Molecular Formula | C16H24BNO3S |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | cyclopropylimino-methyl-oxo-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-λ6-sulfane |
| SMILES | CC1(C)OB(c2ccc(S(C)(=O)=NC3CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H24BNO3S/c1-15(2)16(3,4)21-17(20-15)12-6-10-14(11-7-12)22(5,19)18-13-8-9-13/h6-7,10-11,13H,8-9H2,1-5H3 |
| InChIKey | QWQGLENMOOKOBR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|