C23H34BNO4 — CID 68577008
(2S)-2-cyclohexyl-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylamino]acetic acid (PubChem CID 68577008) has the molecular formula C23H34BNO4 and a molecular weight of 399.34 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylamino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 68577008 |
| Molecular Formula | C23H34BNO4 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enylamino]acetic acid |
| SMILES | CC1(C)OB(c2ccc(C=CCN[C@H](C(=O)O)C3CCCCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C23H34BNO4/c1-22(2)23(3,4)29-24(28-22)19-14-12-17(13-15-19)9-8-16-25-20(21(26)27)18-10-6-5-7-11-18/h8-9,12-15,18,20,25H,5-7,10-11,16H2,1-4H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | ORDUPEUGQCUIBG-FQEVSTJZSA-N |
| XLogP | 3.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|