C19H25NO4 — CID 149301343
(2S)-2-cyclohexyl-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]acetic acid (PubChem CID 149301343) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 149301343 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]acetic acid |
| SMILES | O=C(/C=C/c1ccc(CN[C@H](C(=O)O)C2CCCCC2)cc1)CO |
| InChI | InChI=1S/C19H25NO4/c21-13-17(22)11-10-14-6-8-15(9-7-14)12-20-18(19(23)24)16-4-2-1-3-5-16/h6-11,16,18,20-21H,1-5,12-13H2,(H,23,24)/b11-10+/t18-/m0/s1 |
| InChIKey | XWUWRTIDLBYGIR-ZGKFYVQTSA-N |
| XLogP | 2.38 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|