C31H45NO4 — CID 160512519
cyclopentyl (2S)-2-cyclohexyl-4-[1-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]piperidin-4-yl]butanoate (PubChem CID 160512519) has the molecular formula C31H45NO4 and a molecular weight of 495.70 g/mol. Its IUPAC name is cyclopentyl (2S)-2-cyclohexyl-4-[1-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]piperidin-4-yl]butanoate.
| Compound Name | cyclopentyl (2S)-2-cyclohexyl-4-[1-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]piperidin-4-yl]butanoate |
|---|---|
| PubChem CID | 160512519 |
| Molecular Formula | C31H45NO4 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | cyclopentyl (2S)-2-cyclohexyl-4-[1-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]piperidin-4-yl]butanoate |
| SMILES | O=C(/C=C/c1ccc(CN2CCC(CC[C@H](C(=O)OC3CCCC3)C3CCCCC3)CC2)cc1)CO |
| InChI | InChI=1S/C31H45NO4/c33-23-28(34)16-14-24-10-12-26(13-11-24)22-32-20-18-25(19-21-32)15-17-30(27-6-2-1-3-7-27)31(35)36-29-8-4-5-9-29/h10-14,16,25,27,29-30,33H,1-9,15,17-23H2/b16-14+/t30-/m0/s1 |
| InChIKey | QTFPHVDUQOITEG-TXBAALFESA-N |
| XLogP | 5.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|