C27H37N3OS — CID 145307580
benzene;(E)-3-[4-[[4-[(cyclopropylamino)methyl]piperidin-1-yl]methyl]phenyl]-N-methyl-N-methylsulfanylprop-2-enamide (PubChem CID 145307580) has the molecular formula C27H37N3OS and a molecular weight of 451.68 g/mol. Its IUPAC name is benzene;(E)-3-[4-[[4-[(cyclopropylamino)methyl]piperidin-1-yl]methyl]phenyl]-N-methyl-N-methylsulfanylprop-2-enamide.
| Compound Name | benzene;(E)-3-[4-[[4-[(cyclopropylamino)methyl]piperidin-1-yl]methyl]phenyl]-N-methyl-N-methylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 145307580 |
| Molecular Formula | C27H37N3OS |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | benzene;(E)-3-[4-[[4-[(cyclopropylamino)methyl]piperidin-1-yl]methyl]phenyl]-N-methyl-N-methylsulfanylprop-2-enamide |
| SMILES | CSN(C)C(=O)/C=C/c1ccc(CN2CCC(CNC3CC3)CC2)cc1.c1ccccc1 |
| InChI | InChI=1S/C21H31N3OS.C6H6/c1-23(26-2)21(25)10-7-17-3-5-19(6-4-17)16-24-13-11-18(12-14-24)15-22-20-8-9-20;1-2-4-6-5-3-1/h3-7,10,18,20,22H,8-9,11-16H2,1-2H3;1-6H/b10-7+; |
| InChIKey | UGGWIJDTCYMDDB-HCUGZAAXSA-N |
| XLogP | 5.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|