C25H28N2O3 — CID 67051197
methyl (E)-3-[4-[[4-(1-oxo-3,4-dihydroisoquinolin-2-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate (PubChem CID 67051197) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl (E)-3-[4-[[4-(1-oxo-3,4-dihydroisoquinolin-2-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[4-(1-oxo-3,4-dihydroisoquinolin-2-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67051197 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | methyl (E)-3-[4-[[4-(1-oxo-3,4-dihydroisoquinolin-2-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(CN2CCC(N3CCc4ccccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-30-24(28)11-10-19-6-8-20(9-7-19)18-26-15-13-22(14-16-26)27-17-12-21-4-2-3-5-23(21)25(27)29/h2-11,22H,12-18H2,1H3/b11-10+ |
| InChIKey | GFBLSQZXVNKLOM-ZHACJKMWSA-N |
| XLogP | 3.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|