C19H23N3O2 — CID 58183044
methyl (E)-3-[4-[[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]prop-2-enoate (PubChem CID 58183044) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is methyl (E)-3-[4-[[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58183044 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | methyl (E)-3-[4-[[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(CN2CCC[C@@H]2Cn2cccn2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-24-19(23)10-9-16-5-7-17(8-6-16)14-21-12-2-4-18(21)15-22-13-3-11-20-22/h3,5-11,13,18H,2,4,12,14-15H2,1H3/b10-9+/t18-/m1/s1 |
| InChIKey | QIHRFNVPDLNRMW-QZEKMECESA-N |
| XLogP | 2.73 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|