C24H26N2O2 — CID 46198003
methyl (E)-3-[4-[[3-(1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate (PubChem CID 46198003) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (E)-3-[4-[[3-(1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[3-(1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 46198003 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl (E)-3-[4-[[3-(1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(CN2CCCC(c3c[nH]c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C24H26N2O2/c1-28-24(27)13-12-18-8-10-19(11-9-18)16-26-14-4-5-20(17-26)22-15-25-23-7-3-2-6-21(22)23/h2-3,6-13,15,20,25H,4-5,14,16-17H2,1H3/b13-12+ |
| InChIKey | MYXIDYUTRACLOT-OUKQBFOZSA-N |
| XLogP | 4.73 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|