C25H28N2O2 — CID 66584527
methyl 3-[4-[(1R)-1-[(2R)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]ethyl]phenyl]prop-2-enoate (PubChem CID 66584527) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is methyl 3-[4-[(1R)-1-[(2R)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]ethyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[(1R)-1-[(2R)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]ethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 66584527 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl 3-[4-[(1R)-1-[(2R)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]ethyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc([C@@H](C)N2CCC[C@@H]2Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-18(20-12-9-19(10-13-20)11-14-25(28)29-2)27-15-5-6-22(27)16-21-17-26-24-8-4-3-7-23(21)24/h3-4,7-14,17-18,22,26H,5-6,15-16H2,1-2H3/t18-,22-/m1/s1 |
| InChIKey | GCVFSKFGPVHCJT-XMSQKQJNSA-N |
| XLogP | 5.12 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|