C23H24FN3O2 — CID 123585685
3-[3-fluoro-4-[[(2S)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 123585685) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 3-[3-fluoro-4-[[(2S)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[3-fluoro-4-[[(2S)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 123585685 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-[3-fluoro-4-[[(2S)-2-(1H-indol-3-ylmethyl)pyrrolidin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(CN2CCC[C@H]2Cc2c[nH]c3ccccc23)c(F)c1)NO |
| InChI | InChI=1S/C23H24FN3O2/c24-21-12-16(8-10-23(28)26-29)7-9-17(21)15-27-11-3-4-19(27)13-18-14-25-22-6-2-1-5-20(18)22/h1-2,5-10,12,14,19,25,29H,3-4,11,13,15H2,(H,26,28)/t19-/m0/s1 |
| InChIKey | ZWEPJYOFOTTWOZ-IBGZPJMESA-N |
| XLogP | 4.03 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|