C30H37N5O3 — CID 76838850
3-[1-[2-(4-acetylpiperazin-1-yl)ethyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838850) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is 3-[1-[2-(4-acetylpiperazin-1-yl)ethyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[2-(4-acetylpiperazin-1-yl)ethyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838850 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 3-[1-[2-(4-acetylpiperazin-1-yl)ethyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CC(=O)N1CCN(CCN(CCc2c[nH]c3ccccc23)C2CCc3cc(C=CC(=O)NO)ccc32)CC1 |
| InChI | InChI=1S/C30H37N5O3/c1-22(36)34-17-14-33(15-18-34)16-19-35(13-12-25-21-31-28-5-3-2-4-26(25)28)29-10-8-24-20-23(6-9-27(24)29)7-11-30(37)32-38/h2-7,9,11,20-21,29,31,38H,8,10,12-19H2,1H3,(H,32,37) |
| InChIKey | IWCVWXRAJUMEJJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|