C29H36N5O4S- — CID 174503456
[4-[2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]piperazin-1-yl]methanesulfinate (PubChem CID 174503456) has the molecular formula C29H36N5O4S- and a molecular weight of 550.71 g/mol. Its IUPAC name is [4-[2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]piperazin-1-yl]methanesulfinate.
| Compound Name | [4-[2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]piperazin-1-yl]methanesulfinate |
|---|---|
| PubChem CID | 174503456 |
| Molecular Formula | C29H36N5O4S- |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | [4-[2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]piperazin-1-yl]methanesulfinate |
| SMILES | O=C(C=Cc1ccc2c(c1)CCC2N(CCc1c[nH]c2ccccc12)CCN1CCN(CS(=O)[O-])CC1)NO |
| InChI | InChI=1S/C29H37N5O4S/c35-29(31-36)10-6-22-5-8-26-23(19-22)7-9-28(26)34(12-11-24-20-30-27-4-2-1-3-25(24)27)18-17-32-13-15-33(16-14-32)21-39(37)38/h1-6,8,10,19-20,28,30,36H,7,9,11-18,21H2,(H,31,35)(H,37,38)/p-1 |
| InChIKey | XFZIIQWNDQBURF-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|