C30H30N4O3 — CID 58613667
4-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]benzamide (PubChem CID 58613667) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is 4-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]benzamide.
| Compound Name | 4-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 58613667 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 4-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN(CCc2c[nH]c3ccccc23)C2CCc3cc(/C=C/C(=O)NO)ccc32)cc1 |
| InChI | InChI=1S/C30H30N4O3/c31-30(36)22-9-5-21(6-10-22)19-34(16-15-24-18-32-27-4-2-1-3-25(24)27)28-13-11-23-17-20(7-12-26(23)28)8-14-29(35)33-37/h1-10,12,14,17-18,28,32,37H,11,13,15-16,19H2,(H2,31,36)(H,33,35)/b14-8+ |
| InChIKey | UTMGVHDDSXTKNE-RIYZIHGNSA-N |
| XLogP | 4.52 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|