C33H37N5O3 — CID 76838816
3-[1-[[4-[(ethylcarbamoylamino)methyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838816) has the molecular formula C33H37N5O3 and a molecular weight of 551.69 g/mol. Its IUPAC name is 3-[1-[[4-[(ethylcarbamoylamino)methyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[[4-[(ethylcarbamoylamino)methyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838816 |
| Molecular Formula | C33H37N5O3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 3-[1-[[4-[(ethylcarbamoylamino)methyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCNC(=O)NCc1ccc(CN(CCc2c[nH]c3ccccc23)C2CCc3cc(C=CC(=O)NO)ccc32)cc1 |
| InChI | InChI=1S/C33H37N5O3/c1-2-34-33(40)36-20-24-7-9-25(10-8-24)22-38(18-17-27-21-35-30-6-4-3-5-28(27)30)31-15-13-26-19-23(11-14-29(26)31)12-16-32(39)37-41/h3-12,14,16,19,21,31,35,41H,2,13,15,17-18,20,22H2,1H3,(H,37,39)(H2,34,36,40) |
| InChIKey | IPFVNYOVPIAMGO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|