C29H32N4O2 — CID 76838255
3-[1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838255) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-[1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838255 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-[1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1c[nH]c(C)c1CN(CCc1c[nH]c2ccccc12)C1CCc2cc(C=CC(=O)NO)ccc21 |
| InChI | InChI=1S/C29H32N4O2/c1-19-16-30-20(2)26(19)18-33(14-13-23-17-31-27-6-4-3-5-24(23)27)28-11-9-22-15-21(7-10-25(22)28)8-12-29(34)32-35/h3-8,10,12,15-17,28,30-31,35H,9,11,13-14,18H2,1-2H3,(H,32,34) |
| InChIKey | GCCCAQXHAKMTHZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|