C27H29N5O2 — CID 58613601
(E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 58613601) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 58613601 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | Cc1cc(CN(CCc2c[nH]c3ccccc23)C2CCc3cc(/C=C/C(=O)NO)ccc32)n[nH]1 |
| InChI | InChI=1S/C27H29N5O2/c1-18-14-22(30-29-18)17-32(13-12-21-16-28-25-5-3-2-4-23(21)25)26-10-8-20-15-19(6-9-24(20)26)7-11-27(33)31-34/h2-7,9,11,14-16,26,28,34H,8,10,12-13,17H2,1H3,(H,29,30)(H,31,33)/b11-7+ |
| InChIKey | MLPRGMIUDAMENS-YRNVUSSQSA-N |
| XLogP | 4.45 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|