C29H31N5O3 — CID 76838151
5-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrrole-2-carboxamide (PubChem CID 76838151) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 5-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | 5-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 76838151 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 5-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CNC(=O)c1ccc(CN(CCc2c[nH]c3ccccc23)C2CCc3cc(C=CC(=O)NO)ccc32)[nH]1 |
| InChI | InChI=1S/C29H31N5O3/c1-30-29(36)26-11-9-22(32-26)18-34(15-14-21-17-31-25-5-3-2-4-23(21)25)27-12-8-20-16-19(6-10-24(20)27)7-13-28(35)33-37/h2-7,9-11,13,16-17,27,31-32,37H,8,12,14-15,18H2,1H3,(H,30,36)(H,33,35) |
| InChIKey | IRKGBTOFOJOWLK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|