C30H33N5O3 — CID 58613855
5-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide (PubChem CID 58613855) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is 5-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 5-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 58613855 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 5-[[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(CN(CCc2c[nH]c3ccccc23)C2CCc3cc(/C=C/C(=O)NO)ccc32)[nH]1 |
| InChI | InChI=1S/C30H33N5O3/c1-34(2)30(37)27-12-10-23(32-27)19-35(16-15-22-18-31-26-6-4-3-5-24(22)26)28-13-9-21-17-20(7-11-25(21)28)8-14-29(36)33-38/h3-8,10-12,14,17-18,28,31-32,38H,9,13,15-16,19H2,1-2H3,(H,33,36)/b14-8+ |
| InChIKey | SLYNKZBANOVAKF-RIYZIHGNSA-N |
| XLogP | 4.45 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|