C29H37N5O4S — CID 76838002
N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 76838002) has the molecular formula C29H37N5O4S and a molecular weight of 551.71 g/mol. Its IUPAC name is N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 76838002 |
| Molecular Formula | C29H37N5O4S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(CCN(CCc2c[nH]c3ccccc23)C2CCc3cc(C=CC(=O)NO)ccc32)CC1 |
| InChI | InChI=1S/C29H37N5O4S/c1-39(37,38)34-18-15-32(16-19-34)14-17-33(13-12-24-21-30-27-5-3-2-4-25(24)27)28-10-8-23-20-22(6-9-26(23)28)7-11-29(35)31-36/h2-7,9,11,20-21,28,30,36H,8,10,12-19H2,1H3,(H,31,35) |
| InChIKey | XSFHIUHTKLETBJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|