C29H35N5O4 — CID 58614072
N-[2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]morpholine-4-carboxamide (PubChem CID 58614072) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 58614072 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | N-[2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(1H-indol-3-yl)ethyl]amino]ethyl]morpholine-4-carboxamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2N(CCNC(=O)N1CCOCC1)CCc1c[nH]c2ccccc12)NO |
| InChI | InChI=1S/C29H35N5O4/c35-28(32-37)10-6-21-5-8-25-22(19-21)7-9-27(25)33(14-12-30-29(36)34-15-17-38-18-16-34)13-11-23-20-31-26-4-2-1-3-24(23)26/h1-6,8,10,19-20,27,31,37H,7,9,11-18H2,(H,30,36)(H,32,35)/b10-6+ |
| InChIKey | BRSGZMMIFJTITL-UXBLZVDNSA-N |
| XLogP | 3.26 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|