C35H41N5O5S — CID 58614241
(E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[[4-(2-morpholin-4-ylethylsulfamoyl)phenyl]methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 58614241) has the molecular formula C35H41N5O5S and a molecular weight of 643.81 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[[4-(2-morpholin-4-ylethylsulfamoyl)phenyl]methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[[4-(2-morpholin-4-ylethylsulfamoyl)phenyl]methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 58614241 |
| Molecular Formula | C35H41N5O5S |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-[[4-(2-morpholin-4-ylethylsulfamoyl)phenyl]methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2N(CCc1c[nH]c2ccccc12)Cc1ccc(S(=O)(=O)NCCN2CCOCC2)cc1)NO |
| InChI | InChI=1S/C35H41N5O5S/c41-35(38-42)14-8-26-7-12-32-28(23-26)9-13-34(32)40(17-15-29-24-36-33-4-2-1-3-31(29)33)25-27-5-10-30(11-6-27)46(43,44)37-16-18-39-19-21-45-22-20-39/h1-8,10-12,14,23-24,34,36-37,42H,9,13,15-22,25H2,(H,38,41)/b14-8+ |
| InChIKey | YQPDEDLVJYPMJL-RIYZIHGNSA-N |
| XLogP | 4.03 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|