C23H23N3O4 — CID 58614559
2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 58614559) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 58614559 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2NC(Cc1c[nH]c2ccccc12)C(=O)O)NO |
| InChI | InChI=1S/C23H23N3O4/c27-22(26-30)10-6-14-5-8-18-15(11-14)7-9-20(18)25-21(23(28)29)12-16-13-24-19-4-2-1-3-17(16)19/h1-6,8,10-11,13,20-21,24-25,30H,7,9,12H2,(H,26,27)(H,28,29)/b10-6+ |
| InChIKey | IAEQJIMSSHGGBP-UXBLZVDNSA-N |
| XLogP | 2.96 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|